C22H16FN3O6S — CID 108682641
3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(4-fluorophenyl)-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 108682641) has the molecular formula C22H16FN3O6S and a molecular weight of 469.45 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(4-fluorophenyl)-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(4-fluorophenyl)-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108682641 |
| Molecular Formula | C22H16FN3O6S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | 3-(2,4-dimethyl-1,3-thiazole-5-carbonyl)-1-(4-fluorophenyl)-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | Cc1nc(C)c(C(=O)C2=C(O)C(=O)N(c3ccc(F)cc3)C2c2ccc(O)c([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C22H16FN3O6S/c1-10-21(33-11(2)24-10)19(28)17-18(12-3-8-16(27)15(9-12)26(31)32)25(22(30)20(17)29)14-6-4-13(23)5-7-14/h3-9,18,27,29H,1-2H3 |
| InChIKey | YVQVQBJERZDDNT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|