C29H27NO7 — CID 108683368
methyl 4-[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108683368) has the molecular formula C29H27NO7 and a molecular weight of 501.54 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108683368 |
| Molecular Formula | C29H27NO7 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | methyl 4-[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCc1ccc(C2/C(=C(/O)c3ccc(OC)c(OC)c3)C(=O)C(=O)N2c2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C29H27NO7/c1-5-17-6-8-18(9-7-17)25-24(26(31)20-12-15-22(35-2)23(16-20)36-3)27(32)28(33)30(25)21-13-10-19(11-14-21)29(34)37-4/h6-16,25,31H,5H2,1-4H3/b26-24- |
| InChIKey | AFVWKJQLOQKEAQ-LCUIJRPUSA-N |
| XLogP | 4.68 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|