C28H25ClN2O5 — CID 108683803
N-[3-[(3E)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide (PubChem CID 108683803) has the molecular formula C28H25ClN2O5 and a molecular weight of 504.97 g/mol. Its IUPAC name is N-[3-[(3E)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[(3E)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 108683803 |
| Molecular Formula | C28H25ClN2O5 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | N-[3-[(3E)-3-[(3-chloro-4-methoxyphenyl)-hydroxymethylidene]-2-(4-ethylphenyl)-4,5-dioxopyrrolidin-1-yl]phenyl]acetamide |
| SMILES | CCc1ccc(C2/C(=C(\O)c3ccc(OC)c(Cl)c3)C(=O)C(=O)N2c2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C28H25ClN2O5/c1-4-17-8-10-18(11-9-17)25-24(26(33)19-12-13-23(36-3)22(29)14-19)27(34)28(35)31(25)21-7-5-6-20(15-21)30-16(2)32/h5-15,25,33H,4H2,1-3H3,(H,30,32)/b26-24+ |
| InChIKey | TWEITEFUMYKOKZ-SHHOIMCASA-N |
| XLogP | 5.50 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|