C33H34N2O4 — CID 108683996
(4E)-1-(3,5-dimethylphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108683996) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is (4E)-1-(3,5-dimethylphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3,5-dimethylphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108683996 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (4E)-1-(3,5-dimethylphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3cc(C)cc(C)c3)C2c2cn(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H34N2O4/c1-5-6-9-16-39-25-14-12-23(13-15-25)31(36)29-30(27-20-34(4)28-11-8-7-10-26(27)28)35(33(38)32(29)37)24-18-21(2)17-22(3)19-24/h7-8,10-15,17-20,30,36H,5-6,9,16H2,1-4H3/b31-29+ |
| InChIKey | FKKZTHQVLVZGJY-OWWNRXNESA-N |
| XLogP | 6.99 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|