C12H19NO4 — CID 10868431
methyl (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylate (PubChem CID 10868431) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is methyl (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 10868431 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | methyl (4S,5R)-5-[(E,2R)-hex-4-en-2-yl]-3-methyl-2-oxo-1,3-oxazolidine-4-carboxylate |
| SMILES | C/C=C/C[C@@H](C)[C@H]1OC(=O)N(C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C12H19NO4/c1-5-6-7-8(2)10-9(11(14)16-4)13(3)12(15)17-10/h5-6,8-10H,7H2,1-4H3/b6-5+/t8-,9+,10-/m1/s1 |
| InChIKey | GGVWOJLXQGFZQE-RNWMEYJFSA-N |
| XLogP | 1.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|