C26H17Cl3N2O3 — CID 108684339
(4E)-1-(4-chlorophenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108684339) has the molecular formula C26H17Cl3N2O3 and a molecular weight of 511.79 g/mol. Its IUPAC name is (4E)-1-(4-chlorophenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4-chlorophenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108684339 |
| Molecular Formula | C26H17Cl3N2O3 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 510.03 |
| IUPAC Name | (4E)-1-(4-chlorophenyl)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(1-methylindol-3-yl)pyrrolidine-2,3-dione |
| SMILES | Cn1cc(C2/C(=C(\O)c3ccc(Cl)c(Cl)c3)C(=O)C(=O)N2c2ccc(Cl)cc2)c2ccccc21 |
| InChI | InChI=1S/C26H17Cl3N2O3/c1-30-13-18(17-4-2-3-5-21(17)30)23-22(24(32)14-6-11-19(28)20(29)12-14)25(33)26(34)31(23)16-9-7-15(27)8-10-16/h2-13,23,32H,1H3/b24-22+ |
| InChIKey | XVRYZVYXKQGGIW-ZNTNEXAZSA-N |
| XLogP | 6.76 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|