C14H27NO2 — CID 10868437
(2Z,4S)-2-(2-methylpropylidene)-4-[(2S)-piperidin-2-yl]pentane-1,4-diol (PubChem CID 10868437) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (2Z,4S)-2-(2-methylpropylidene)-4-[(2S)-piperidin-2-yl]pentane-1,4-diol.
| Compound Name | (2Z,4S)-2-(2-methylpropylidene)-4-[(2S)-piperidin-2-yl]pentane-1,4-diol |
|---|---|
| PubChem CID | 10868437 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (2Z,4S)-2-(2-methylpropylidene)-4-[(2S)-piperidin-2-yl]pentane-1,4-diol |
| SMILES | CC(C)/C=C(\CO)C[C@](C)(O)[C@@H]1CCCCN1 |
| InChI | InChI=1S/C14H27NO2/c1-11(2)8-12(10-16)9-14(3,17)13-6-4-5-7-15-13/h8,11,13,15-17H,4-7,9-10H2,1-3H3/b12-8-/t13-,14-/m0/s1 |
| InChIKey | WNKTYCDFNFKEHR-KGKULNKVSA-N |
| XLogP | 1.84 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|