C26H19BrF3NO4 — CID 108685329
(4E)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione (PubChem CID 108685329) has the molecular formula C26H19BrF3NO4 and a molecular weight of 546.34 g/mol. Its IUPAC name is (4E)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108685329 |
| Molecular Formula | C26H19BrF3NO4 |
| Molecular Weight | 546.34 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | (4E)-4-[(3-bromo-4-methoxyphenyl)-hydroxymethylidene]-5-(2-methylphenyl)-1-[3-(trifluoromethyl)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3cccc(C(F)(F)F)c3)C2c2ccccc2C)cc1Br |
| InChI | InChI=1S/C26H19BrF3NO4/c1-14-6-3-4-9-18(14)22-21(23(32)15-10-11-20(35-2)19(27)12-15)24(33)25(34)31(22)17-8-5-7-16(13-17)26(28,29)30/h3-13,22,32H,1-2H3/b23-21+ |
| InChIKey | IMNCQDKIPNBDCV-XTQSDGFTSA-N |
| XLogP | 6.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.34 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|