C24H16Cl2F3NO6 — CID 108685889
(4Z)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione (PubChem CID 108685889) has the molecular formula C24H16Cl2F3NO6 and a molecular weight of 542.29 g/mol. Its IUPAC name is (4Z)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108685889 |
| Molecular Formula | C24H16Cl2F3NO6 |
| Molecular Weight | 542.29 g/mol |
| Exact Mass | 541.03 |
| IUPAC Name | (4Z)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-5-(5-methylfuran-2-yl)-1-[4-(trifluoromethoxy)phenyl]pyrrolidine-2,3-dione |
| SMILES | COc1c(Cl)cc(/C(O)=C2/C(=O)C(=O)N(c3ccc(OC(F)(F)F)cc3)C2c2ccc(C)o2)cc1Cl |
| InChI | InChI=1S/C24H16Cl2F3NO6/c1-11-3-8-17(35-11)19-18(20(31)12-9-15(25)22(34-2)16(26)10-12)21(32)23(33)30(19)13-4-6-14(7-5-13)36-24(27,28)29/h3-10,19,31H,1-2H3/b20-18- |
| InChIKey | LGGHXIFUUVUUQY-ZZEZOPTASA-N |
| XLogP | 6.43 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.29 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|