C30H24N2O4 — CID 108686500
3-(1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-2-(2-methyl-1H-indol-3-yl)-2H-pyrrol-5-one (PubChem CID 108686500) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is 3-(1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-2-(2-methyl-1H-indol-3-yl)-2H-pyrrol-5-one.
| Compound Name | 3-(1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-2-(2-methyl-1H-indol-3-yl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108686500 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 3-(1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-2-(2-methyl-1H-indol-3-yl)-2H-pyrrol-5-one |
| SMILES | CCc1ccc(N2C(=O)C(O)=C(C(=O)c3cc4ccccc4o3)C2c2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C30H24N2O4/c1-3-18-12-14-20(15-13-18)32-27(25-17(2)31-22-10-6-5-9-21(22)25)26(29(34)30(32)35)28(33)24-16-19-8-4-7-11-23(19)36-24/h4-16,27,31,34H,3H2,1-2H3 |
| InChIKey | WUHOJQMVWHNALP-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|