About (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol
(3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol (PubChem CID 10868723) has the molecular formula C14H18O2S
and a molecular weight of 250.36 g/mol. Its IUPAC name is (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol.
Molecular Properties
| Compound Name | (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol |
| PubChem CID | 10868723 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol |
| SMILES | C#CC[C@@H](O)C[C@H](O)CCSc1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c1-2-6-12(15)11-13(16)9-10-17-14-7-4-3-5-8-14/h1,3-5,7-8,12-13,15-16H,6,9-11H2/t12-,13-/m1/s1 |
| InChIKey | NEUUEQTYBFIBNL-CHWSQXEVSA-N |
| XLogP | 2.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol?
The IUPAC name of (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol (CID 10868723) is (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol.
What is the SMILES notation for (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol?
The canonical SMILES for (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol is C#CC[C@@H](O)C[C@H](O)CCSc1ccccc1.
What is the InChIKey of (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol?
The InChIKey is NEUUEQTYBFIBNL-CHWSQXEVSA-N. The full InChI is InChI=1S/C14H18O2S/c1-2-6-12(15)11-13(16)9-10-17-14-7-4-3-5-8-14/h1,3-5,7-8,12-13,15-16H,6,9-11H2/t12-,13-/m1/s1.
What are the key properties of (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol?
(3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol has a molecular weight of 250.36 g/mol, XLogP of 2.30, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-1-phenylsulfanyloct-7-yne-3,5-diol is sourced from PubChem (CID 10868723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).