About (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol
(E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol (PubChem CID 10868727) has the molecular formula C14H22O2Si
and a molecular weight of 250.41 g/mol. Its IUPAC name is (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol.
Molecular Properties
| Compound Name | (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol |
| PubChem CID | 10868727 |
| Molecular Formula | C14H22O2Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol |
| SMILES | C#C/C(=C\C#C[Si](C)(C)C(C)(C)C)[C@H](O)CO |
| InChI | InChI=1S/C14H22O2Si/c1-7-12(13(16)11-15)9-8-10-17(5,6)14(2,3)4/h1,9,13,15-16H,11H2,2-6H3/b12-9+/t13-/m1/s1 |
| InChIKey | UWNNDKSCGUJCMX-CNELAYHGSA-N |
| XLogP | 1.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol?
The IUPAC name of (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol (CID 10868727) is (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol.
What is the SMILES notation for (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol?
The canonical SMILES for (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol is C#C/C(=C\C#C[Si](C)(C)C(C)(C)C)[C@H](O)CO.
What is the InChIKey of (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol?
The InChIKey is UWNNDKSCGUJCMX-CNELAYHGSA-N. The full InChI is InChI=1S/C14H22O2Si/c1-7-12(13(16)11-15)9-8-10-17(5,6)14(2,3)4/h1,9,13,15-16H,11H2,2-6H3/b12-9+/t13-/m1/s1.
What are the key properties of (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol?
(E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol has a molecular weight of 250.41 g/mol, XLogP of 1.95, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-6-[tert-butyl(dimethyl)silyl]-3-ethynylhex-3-en-5-yne-1,2-diol is sourced from PubChem (CID 10868727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).