C29H27NO7 — CID 108687692
[4-[(3Z)-3-[hydroxy-(3-propoxyphenyl)methylidene]-1-(4-methoxyphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108687692) has the molecular formula C29H27NO7 and a molecular weight of 501.54 g/mol. Its IUPAC name is [4-[(3Z)-3-[hydroxy-(3-propoxyphenyl)methylidene]-1-(4-methoxyphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-3-[hydroxy-(3-propoxyphenyl)methylidene]-1-(4-methoxyphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687692 |
| Molecular Formula | C29H27NO7 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [4-[(3Z)-3-[hydroxy-(3-propoxyphenyl)methylidene]-1-(4-methoxyphenyl)-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCCOc1cccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(OC)cc3)C2c2ccc(OC(C)=O)cc2)c1 |
| InChI | InChI=1S/C29H27NO7/c1-4-16-36-24-7-5-6-20(17-24)27(32)25-26(19-8-12-23(13-9-19)37-18(2)31)30(29(34)28(25)33)21-10-14-22(35-3)15-11-21/h5-15,17,26,32H,4,16H2,1-3H3/b27-25- |
| InChIKey | QEMDAHKDJKZYCO-RFBIWTDZSA-N |
| XLogP | 5.04 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|