C29H27F2NO6 — CID 108688600
(4E)-1-(3,4-difluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108688600) has the molecular formula C29H27F2NO6 and a molecular weight of 523.53 g/mol. Its IUPAC name is (4E)-1-(3,4-difluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3,4-difluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108688600 |
| Molecular Formula | C29H27F2NO6 |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | (4E)-1-(3,4-difluorophenyl)-5-(3-hydroxy-4-methoxyphenyl)-4-[hydroxy-(4-pentoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc(F)c(F)c3)C2c2ccc(OC)c(O)c2)cc1 |
| InChI | InChI=1S/C29H27F2NO6/c1-3-4-5-14-38-20-10-6-17(7-11-20)27(34)25-26(18-8-13-24(37-2)23(33)15-18)32(29(36)28(25)35)19-9-12-21(30)22(31)16-19/h6-13,15-16,26,33-34H,3-5,14H2,1-2H3/b27-25+ |
| InChIKey | KYIURURCFRGJKV-IMVLJIQESA-N |
| XLogP | 5.87 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|