C27H21ClN2O4 — CID 108689019
4-[(4Z)-4-[(3-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-propoxyphenyl)pyrrolidin-1-yl]benzonitrile (PubChem CID 108689019) has the molecular formula C27H21ClN2O4 and a molecular weight of 472.93 g/mol. Its IUPAC name is 4-[(4Z)-4-[(3-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-propoxyphenyl)pyrrolidin-1-yl]benzonitrile.
| Compound Name | 4-[(4Z)-4-[(3-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-propoxyphenyl)pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 108689019 |
| Molecular Formula | C27H21ClN2O4 |
| Molecular Weight | 472.93 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 4-[(4Z)-4-[(3-chlorophenyl)-hydroxymethylidene]-2,3-dioxo-5-(3-propoxyphenyl)pyrrolidin-1-yl]benzonitrile |
| SMILES | CCCOc1cccc(C2/C(=C(/O)c3cccc(Cl)c3)C(=O)C(=O)N2c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C27H21ClN2O4/c1-2-13-34-22-8-4-5-18(15-22)24-23(25(31)19-6-3-7-20(28)14-19)26(32)27(33)30(24)21-11-9-17(16-29)10-12-21/h3-12,14-15,24,31H,2,13H2,1H3/b25-23- |
| InChIKey | JGVBENKOFWUFQD-BZZOAKBMSA-N |
| XLogP | 5.63 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.93 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|