C32H33NO7 — CID 108689072
4-[[(3Z)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 108689072) has the molecular formula C32H33NO7 and a molecular weight of 543.62 g/mol. Its IUPAC name is 4-[[(3Z)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3Z)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 108689072 |
| Molecular Formula | C32H33NO7 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | 4-[[(3Z)-3-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(Cc3ccc(C(=O)O)cc3)C2c2ccc(OC)cc2)cc1C(C)(C)C |
| InChI | InChI=1S/C32H33NO7/c1-6-40-25-16-13-22(17-24(25)32(2,3)4)28(34)26-27(20-11-14-23(39-5)15-12-20)33(30(36)29(26)35)18-19-7-9-21(10-8-19)31(37)38/h7-17,27,34H,6,18H2,1-5H3,(H,37,38)/b28-26- |
| InChIKey | CZOCGFGSKOYCFC-SGEDCAFJSA-N |
| XLogP | 5.71 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|