C30H29NO7 — CID 108689086
4-[[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 108689086) has the molecular formula C30H29NO7 and a molecular weight of 515.56 g/mol. Its IUPAC name is 4-[[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 108689086 |
| Molecular Formula | C30H29NO7 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 4-[[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(C2/C(=C(\O)c3cccc(OCC(C)C)c3)C(=O)C(=O)N2Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H29NO7/c1-18(2)17-38-24-6-4-5-22(15-24)27(32)25-26(20-11-13-23(37-3)14-12-20)31(29(34)28(25)33)16-19-7-9-21(10-8-19)30(35)36/h4-15,18,26,32H,16-17H2,1-3H3,(H,35,36)/b27-25+ |
| InChIKey | QRWQPNSAIRLLNC-IMVLJIQESA-N |
| XLogP | 5.05 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|