C28H23NO7 — CID 108689143
4-[[(3Z)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid (PubChem CID 108689143) has the molecular formula C28H23NO7 and a molecular weight of 485.49 g/mol. Its IUPAC name is 4-[[(3Z)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[(3Z)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 108689143 |
| Molecular Formula | C28H23NO7 |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | 4-[[(3Z)-3-[2,3-dihydro-1-benzofuran-5-yl(hydroxy)methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(C2/C(=C(/O)c3ccc4c(c3)CCO4)C(=O)C(=O)N2Cc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H23NO7/c1-35-21-9-6-17(7-10-21)24-23(25(30)20-8-11-22-19(14-20)12-13-36-22)26(31)27(32)29(24)15-16-2-4-18(5-3-16)28(33)34/h2-11,14,24,30H,12-13,15H2,1H3,(H,33,34)/b25-23- |
| InChIKey | WALNHVBEDSVFIN-BZZOAKBMSA-N |
| XLogP | 3.95 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|