C29H27N3O4 — CID 108690342
(4Z)-5-[4-(dimethylamino)phenyl]-4-[hydroxy(1H-indol-3-yl)methylidene]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,3-dione (PubChem CID 108690342) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is (4Z)-5-[4-(dimethylamino)phenyl]-4-[hydroxy(1H-indol-3-yl)methylidene]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-[4-(dimethylamino)phenyl]-4-[hydroxy(1H-indol-3-yl)methylidene]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108690342 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (4Z)-5-[4-(dimethylamino)phenyl]-4-[hydroxy(1H-indol-3-yl)methylidene]-1-[(2-methoxyphenyl)methyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccccc1CN1C(=O)C(=O)/C(=C(\O)c2c[nH]c3ccccc23)C1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C29H27N3O4/c1-31(2)20-14-12-18(13-15-20)26-25(27(33)22-16-30-23-10-6-5-9-21(22)23)28(34)29(35)32(26)17-19-8-4-7-11-24(19)36-3/h4-16,26,30,33H,17H2,1-3H3/b27-25- |
| InChIKey | CFYWVKJUYPGANK-RFBIWTDZSA-N |
| XLogP | 4.86 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|