About 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole
2,5-diphenyl-4-prop-2-enyl-1,3-oxazole (PubChem CID 10869047) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole.
Molecular Properties
| Compound Name | 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole |
| PubChem CID | 10869047 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole |
| SMILES | C=CCc1nc(-c2ccccc2)oc1-c1ccccc1 |
| InChI | InChI=1S/C18H15NO/c1-2-9-16-17(14-10-5-3-6-11-14)20-18(19-16)15-12-7-4-8-13-15/h2-8,10-13H,1,9H2 |
| InChIKey | FCPMQXRWZPEXQO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole?
The IUPAC name of 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole (CID 10869047) is 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole.
What is the SMILES notation for 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole?
The canonical SMILES for 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole is C=CCc1nc(-c2ccccc2)oc1-c1ccccc1.
What is the InChIKey of 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole?
The InChIKey is FCPMQXRWZPEXQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO/c1-2-9-16-17(14-10-5-3-6-11-14)20-18(19-16)15-12-7-4-8-13-15/h2-8,10-13H,1,9H2.
What are the key properties of 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole?
2,5-diphenyl-4-prop-2-enyl-1,3-oxazole has a molecular weight of 261.32 g/mol, XLogP of 4.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenyl-4-prop-2-enyl-1,3-oxazole is sourced from PubChem (CID 10869047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).