C28H25ClN2O7 — CID 108692313
ethyl 4-[[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]methyl]benzoate (PubChem CID 108692313) has the molecular formula C28H25ClN2O7 and a molecular weight of 536.97 g/mol. Its IUPAC name is ethyl 4-[[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108692313 |
| Molecular Formula | C28H25ClN2O7 |
| Molecular Weight | 536.97 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | ethyl 4-[[(4E)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-2,3-dioxo-5-pyridin-2-ylpyrrolidin-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN2C(=O)C(=O)/C(=C(/O)c3cc(OC)c(Cl)cc3OC)C2c2ccccn2)cc1 |
| InChI | InChI=1S/C28H25ClN2O7/c1-4-38-28(35)17-10-8-16(9-11-17)15-31-24(20-7-5-6-12-30-20)23(26(33)27(31)34)25(32)18-13-22(37-3)19(29)14-21(18)36-2/h5-14,24,32H,4,15H2,1-3H3/b25-23+ |
| InChIKey | BEEHDOJIZWIBKF-WJTDDFOZSA-N |
| XLogP | 4.55 |
| TPSA | 115.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.97 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|