C15H26O2Si — CID 10869233
(7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-1,4,5,6,7,7a-hexahydroinden-2-one (PubChem CID 10869233) has the molecular formula C15H26O2Si and a molecular weight of 266.46 g/mol. Its IUPAC name is (7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-1,4,5,6,7,7a-hexahydroinden-2-one.
| Compound Name | (7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-1,4,5,6,7,7a-hexahydroinden-2-one |
|---|---|
| PubChem CID | 10869233 |
| Molecular Formula | C15H26O2Si |
| Molecular Weight | 266.46 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (7S,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-1,4,5,6,7,7a-hexahydroinden-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCC2=CC(=O)C[C@@H]21 |
| InChI | InChI=1S/C15H26O2Si/c1-15(2,3)18(4,5)17-14-8-6-7-11-9-12(16)10-13(11)14/h9,13-14H,6-8,10H2,1-5H3/t13-,14-/m0/s1 |
| InChIKey | OHQJZOVVMDNGKV-KBPBESRZSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|