About ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate
ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate (PubChem CID 10869251) has the molecular formula C14H21NO2S
and a molecular weight of 267.39 g/mol. Its IUPAC name is ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate.
Molecular Properties
| Compound Name | ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate |
| PubChem CID | 10869251 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate |
| SMILES | C=C(Cc1ncc(C)s1)C(C)CCC(=O)OCC |
| InChI | InChI=1S/C14H21NO2S/c1-5-17-14(16)7-6-10(2)11(3)8-13-15-9-12(4)18-13/h9-10H,3,5-8H2,1-2,4H3 |
| InChIKey | CBDGGODNXQNIRQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate?
The IUPAC name of ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate (CID 10869251) is ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate.
What is the SMILES notation for ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate?
The canonical SMILES for ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate is C=C(Cc1ncc(C)s1)C(C)CCC(=O)OCC.
What is the InChIKey of ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate?
The InChIKey is CBDGGODNXQNIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2S/c1-5-17-14(16)7-6-10(2)11(3)8-13-15-9-12(4)18-13/h9-10H,3,5-8H2,1-2,4H3.
What are the key properties of ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate?
ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate has a molecular weight of 267.39 g/mol, XLogP of 3.53, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-methyl-5-[(5-methyl-1,3-thiazol-2-yl)methyl]hex-5-enoate is sourced from PubChem (CID 10869251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).