C28H33NO7 — CID 108693379
(4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-methoxy-4-propan-2-yloxyphenyl)-1-(3-methoxypropyl)pyrrolidine-2,3-dione (PubChem CID 108693379) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-methoxy-4-propan-2-yloxyphenyl)-1-(3-methoxypropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-methoxy-4-propan-2-yloxyphenyl)-1-(3-methoxypropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108693379 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (4E)-4-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-5-(3-methoxy-4-propan-2-yloxyphenyl)-1-(3-methoxypropyl)pyrrolidine-2,3-dione |
| SMILES | COCCCN1C(=O)C(=O)/C(=C(/O)c2ccc3c(c2)CC(C)O3)C1c1ccc(OC(C)C)c(OC)c1 |
| InChI | InChI=1S/C28H33NO7/c1-16(2)35-22-10-7-18(15-23(22)34-5)25-24(27(31)28(32)29(25)11-6-12-33-4)26(30)19-8-9-21-20(14-19)13-17(3)36-21/h7-10,14-17,25,30H,6,11-13H2,1-5H3/b26-24+ |
| InChIKey | AXOJGMIFTDBVQI-SHHOIMCASA-N |
| XLogP | 4.26 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|