C27H33ClN2O6 — CID 108693411
(4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methoxy-4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108693411) has the molecular formula C27H33ClN2O6 and a molecular weight of 517.02 g/mol. Its IUPAC name is (4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methoxy-4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methoxy-4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108693411 |
| Molecular Formula | C27H33ClN2O6 |
| Molecular Weight | 517.02 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | (4Z)-4-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-5-(3-methoxy-4-propan-2-yloxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(/C(O)=C2/C(=O)C(=O)N(CCN(C)C)C2c2ccc(OC(C)C)c(OC)c2)ccc1Cl |
| InChI | InChI=1S/C27H33ClN2O6/c1-7-35-21-15-18(8-10-19(21)28)25(31)23-24(30(13-12-29(4)5)27(33)26(23)32)17-9-11-20(36-16(2)3)22(14-17)34-6/h8-11,14-16,24,31H,7,12-13H2,1-6H3/b25-23- |
| InChIKey | OSHMAPWYWAGDHU-BZZOAKBMSA-N |
| XLogP | 4.52 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.02 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|