C26H30BrNO6 — CID 108693487
(4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propan-2-yloxyphenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione (PubChem CID 108693487) has the molecular formula C26H30BrNO6 and a molecular weight of 532.43 g/mol. Its IUPAC name is (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propan-2-yloxyphenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propan-2-yloxyphenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108693487 |
| Molecular Formula | C26H30BrNO6 |
| Molecular Weight | 532.43 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | (4Z)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-propan-2-yloxyphenyl)-1-(2-methoxyethyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(/O)c3ccc(Br)c(C)c3)C(=O)C(=O)N2CCOC)ccc1OC(C)C |
| InChI | InChI=1S/C26H30BrNO6/c1-6-33-21-14-17(8-10-20(21)34-15(2)3)23-22(25(30)26(31)28(23)11-12-32-5)24(29)18-7-9-19(27)16(4)13-18/h7-10,13-15,23,29H,6,11-12H2,1-5H3/b24-22- |
| InChIKey | MCURCINWXQGUST-GYHWCHFESA-N |
| XLogP | 5.01 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|