C13H20O6 — CID 10869417
methyl (3aR,5S,7aR)-2,2-diethyl-5-hydroxy-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate (PubChem CID 10869417) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl (3aR,5S,7aR)-2,2-diethyl-5-hydroxy-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl (3aR,5S,7aR)-2,2-diethyl-5-hydroxy-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 10869417 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | methyl (3aR,5S,7aR)-2,2-diethyl-5-hydroxy-7-oxo-3a,4,6,7a-tetrahydro-1,3-benzodioxole-5-carboxylate |
| SMILES | CCC1(CC)O[C@@H]2C[C@@](O)(C(=O)OC)CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C13H20O6/c1-4-13(5-2)18-9-7-12(16,11(15)17-3)6-8(14)10(9)19-13/h9-10,16H,4-7H2,1-3H3/t9-,10+,12-/m1/s1 |
| InChIKey | YKQHAYSTJPJUFB-JFGNBEQYSA-N |
| XLogP | 0.55 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |