C25H18Cl2FNO5 — CID 108694303
(4E)-5-(3-chloro-4-hydroxyphenyl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[(4-fluorophenyl)methyl]pyrrolidine-2,3-dione (PubChem CID 108694303) has the molecular formula C25H18Cl2FNO5 and a molecular weight of 502.33 g/mol. Its IUPAC name is (4E)-5-(3-chloro-4-hydroxyphenyl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[(4-fluorophenyl)methyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3-chloro-4-hydroxyphenyl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[(4-fluorophenyl)methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108694303 |
| Molecular Formula | C25H18Cl2FNO5 |
| Molecular Weight | 502.33 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | (4E)-5-(3-chloro-4-hydroxyphenyl)-4-[(2-chloro-5-methoxyphenyl)-hydroxymethylidene]-1-[(4-fluorophenyl)methyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(Cc3ccc(F)cc3)C2c2ccc(O)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H18Cl2FNO5/c1-34-16-7-8-18(26)17(11-16)23(31)21-22(14-4-9-20(30)19(27)10-14)29(25(33)24(21)32)12-13-2-5-15(28)6-3-13/h2-11,22,30-31H,12H2,1H3/b23-21+ |
| InChIKey | PBFHBYRHCZDTKD-XTQSDGFTSA-N |
| XLogP | 5.47 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.33 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|