C33H30FNO4 — CID 108694404
(4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione (PubChem CID 108694404) has the molecular formula C33H30FNO4 and a molecular weight of 523.60 g/mol. Its IUPAC name is (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108694404 |
| Molecular Formula | C33H30FNO4 |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | (4Z)-1-[(4-fluorophenyl)methyl]-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-5-naphthalen-1-ylpyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(Cc3ccc(F)cc3)C2c2cccc3ccccc23)ccc1OCC(C)C |
| InChI | InChI=1S/C33H30FNO4/c1-20(2)19-39-28-16-13-24(17-21(28)3)31(36)29-30(27-10-6-8-23-7-4-5-9-26(23)27)35(33(38)32(29)37)18-22-11-14-25(34)15-12-22/h4-17,20,30,36H,18-19H2,1-3H3/b31-29- |
| InChIKey | RNSNRYPFYUIIJU-YCNYHXFESA-N |
| XLogP | 6.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|