C25H17BrF3NO3 — CID 108694546
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione (PubChem CID 108694546) has the molecular formula C25H17BrF3NO3 and a molecular weight of 516.31 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108694546 |
| Molecular Formula | C25H17BrF3NO3 |
| Molecular Weight | 516.31 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-phenyl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(Cc2cccc(C(F)(F)F)c2)C(c2ccccc2)/C1=C(\O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C25H17BrF3NO3/c26-19-11-9-17(10-12-19)22(31)20-21(16-6-2-1-3-7-16)30(24(33)23(20)32)14-15-5-4-8-18(13-15)25(27,28)29/h1-13,21,31H,14H2/b22-20+ |
| InChIKey | HSTMBEBAMJMXRO-LSDHQDQOSA-N |
| XLogP | 6.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.31 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|