C24H17Cl2FN2O4 — CID 108695350
(4E)-5-(3,4-dichlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 108695350) has the molecular formula C24H17Cl2FN2O4 and a molecular weight of 487.31 g/mol. Its IUPAC name is (4E)-5-(3,4-dichlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(3,4-dichlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108695350 |
| Molecular Formula | C24H17Cl2FN2O4 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | (4E)-5-(3,4-dichlorophenyl)-4-[(5-fluoro-2-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-3-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(F)cc1/C(O)=C1\C(=O)C(=O)N(Cc2cccnc2)C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H17Cl2FN2O4/c1-33-19-7-5-15(27)10-16(19)22(30)20-21(14-4-6-17(25)18(26)9-14)29(24(32)23(20)31)12-13-3-2-8-28-11-13/h2-11,21,30H,12H2,1H3/b22-20+ |
| InChIKey | FECSMIGSALZNOI-LSDHQDQOSA-N |
| XLogP | 5.16 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|