C16H20O4 — CID 10869541
methyl 2-[(2S,4aS)-4a,8-dimethyl-4,7-dioxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate (PubChem CID 10869541) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is methyl 2-[(2S,4aS)-4a,8-dimethyl-4,7-dioxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2S,4aS)-4a,8-dimethyl-4,7-dioxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10869541 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | methyl 2-[(2S,4aS)-4a,8-dimethyl-4,7-dioxo-2,3,5,6-tetrahydro-1H-naphthalen-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC(=O)[C@@]2(C)CCC(=O)C(C)=C2C1 |
| InChI | InChI=1S/C16H20O4/c1-9(15(19)20-4)11-7-12-10(2)13(17)5-6-16(12,3)14(18)8-11/h11H,1,5-8H2,2-4H3/t11-,16-/m0/s1 |
| InChIKey | AMRSTJFDITZUFC-ZBEGNZNMSA-N |
| XLogP | 2.38 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|