C28H23BrN2O4 — CID 108695531
(4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,3-dione (PubChem CID 108695531) has the molecular formula C28H23BrN2O4 and a molecular weight of 531.41 g/mol. Its IUPAC name is (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108695531 |
| Molecular Formula | C28H23BrN2O4 |
| Molecular Weight | 531.41 g/mol |
| Exact Mass | 530.08 |
| IUPAC Name | (4E)-4-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-5-(1H-indol-3-yl)-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(CN2C(=O)C(=O)/C(=C(/O)c3ccc(Br)c(C)c3)C2c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H23BrN2O4/c1-16-13-18(9-12-22(16)29)26(32)24-25(21-14-30-23-6-4-3-5-20(21)23)31(28(34)27(24)33)15-17-7-10-19(35-2)11-8-17/h3-14,25,30,32H,15H2,1-2H3/b26-24+ |
| InChIKey | XXBYMEICYRZFDR-SHHOIMCASA-N |
| XLogP | 5.87 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|