About 2-[4-(1,3-dithian-2-yl)butoxy]oxane
2-[4-(1,3-dithian-2-yl)butoxy]oxane (PubChem CID 10869564) has the molecular formula C13H24O2S2
and a molecular weight of 276.47 g/mol. Its IUPAC name is 2-[4-(1,3-dithian-2-yl)butoxy]oxane.
Molecular Properties
| Compound Name | 2-[4-(1,3-dithian-2-yl)butoxy]oxane |
| PubChem CID | 10869564 |
| Molecular Formula | C13H24O2S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-[4-(1,3-dithian-2-yl)butoxy]oxane |
| SMILES | C1CCC(OCCCCC2SCCCS2)OC1 |
| InChI | InChI=1S/C13H24O2S2/c1-3-8-14-12(6-1)15-9-4-2-7-13-16-10-5-11-17-13/h12-13H,1-11H2 |
| InChIKey | TYIGCPAQNOKWRF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,3-dithian-2-yl)butoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-dithian-2-yl)butoxy]oxane?
The IUPAC name of 2-[4-(1,3-dithian-2-yl)butoxy]oxane (CID 10869564) is 2-[4-(1,3-dithian-2-yl)butoxy]oxane.
What is the SMILES notation for 2-[4-(1,3-dithian-2-yl)butoxy]oxane?
The canonical SMILES for 2-[4-(1,3-dithian-2-yl)butoxy]oxane is C1CCC(OCCCCC2SCCCS2)OC1.
What is the InChIKey of 2-[4-(1,3-dithian-2-yl)butoxy]oxane?
The InChIKey is TYIGCPAQNOKWRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2S2/c1-3-8-14-12(6-1)15-9-4-2-7-13-16-10-5-11-17-13/h12-13H,1-11H2.
What are the key properties of 2-[4-(1,3-dithian-2-yl)butoxy]oxane?
2-[4-(1,3-dithian-2-yl)butoxy]oxane has a molecular weight of 276.47 g/mol, XLogP of 3.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-dithian-2-yl)butoxy]oxane is sourced from PubChem (CID 10869564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).