C27H21Cl2NO7 — CID 108695718
methyl 4-[[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate (PubChem CID 108695718) has the molecular formula C27H21Cl2NO7 and a molecular weight of 542.37 g/mol. Its IUPAC name is methyl 4-[[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108695718 |
| Molecular Formula | C27H21Cl2NO7 |
| Molecular Weight | 542.37 g/mol |
| Exact Mass | 541.07 |
| IUPAC Name | methyl 4-[[(3E)-3-[(3,5-dichloro-2-methoxyphenyl)-hydroxymethylidene]-2-(3-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)C(=O)/C(=C(/O)c3cc(Cl)cc(Cl)c3OC)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C27H21Cl2NO7/c1-36-25-19(11-17(28)12-20(25)29)23(32)21-22(16-4-3-5-18(31)10-16)30(26(34)24(21)33)13-14-6-8-15(9-7-14)27(35)37-2/h3-12,22,31-32H,13H2,1-2H3/b23-21+ |
| InChIKey | BARMQIRIAJVLIT-XTQSDGFTSA-N |
| XLogP | 5.12 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|