C27H20Cl2N2O4 — CID 108695827
(4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione (PubChem CID 108695827) has the molecular formula C27H20Cl2N2O4 and a molecular weight of 507.37 g/mol. Its IUPAC name is (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108695827 |
| Molecular Formula | C27H20Cl2N2O4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (4E)-4-[(3,4-dichlorophenyl)-hydroxymethylidene]-5-(3-hydroxyphenyl)-1-[2-(1H-indol-3-yl)ethyl]pyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(CCc2c[nH]c3ccccc23)C(c2cccc(O)c2)/C1=C(\O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H20Cl2N2O4/c28-20-9-8-16(13-21(20)29)25(33)23-24(15-4-3-5-18(32)12-15)31(27(35)26(23)34)11-10-17-14-30-22-7-2-1-6-19(17)22/h1-9,12-14,24,30,32-33H,10-11H2/b25-23+ |
| InChIKey | CJMIMCDWKUPLFG-WJTDDFOZSA-N |
| XLogP | 5.84 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|