C25H29N3O8 — CID 108695980
(4Z)-1-[2-(diethylamino)ethyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione (PubChem CID 108695980) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is (4Z)-1-[2-(diethylamino)ethyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1-[2-(diethylamino)ethyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108695980 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (4Z)-1-[2-(diethylamino)ethyl]-4-[(2,4-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxy-3-nitrophenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)CCN1C(=O)C(=O)/C(=C(\O)c2ccc(OC)cc2OC)C1c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H29N3O8/c1-5-26(6-2)11-12-27-22(15-7-10-19(29)18(13-15)28(33)34)21(24(31)25(27)32)23(30)17-9-8-16(35-3)14-20(17)36-4/h7-10,13-14,22,29-30H,5-6,11-12H2,1-4H3/b23-21- |
| InChIKey | LNOOOMTVABIHPD-LNVKXUELSA-N |
| XLogP | 3.08 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|