C26H26ClN3O8 — CID 108696030
3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-1-[2-(diethylamino)ethyl]-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 108696030) has the molecular formula C26H26ClN3O8 and a molecular weight of 543.96 g/mol. Its IUPAC name is 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-1-[2-(diethylamino)ethyl]-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-1-[2-(diethylamino)ethyl]-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108696030 |
| Molecular Formula | C26H26ClN3O8 |
| Molecular Weight | 543.96 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 3-(5-chloro-7-methoxy-1-benzofuran-2-carbonyl)-1-[2-(diethylamino)ethyl]-4-hydroxy-2-(4-hydroxy-3-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | CCN(CC)CCN1C(=O)C(O)=C(C(=O)c2cc3cc(Cl)cc(OC)c3o2)C1c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H26ClN3O8/c1-4-28(5-2)8-9-29-22(14-6-7-18(31)17(11-14)30(35)36)21(24(33)26(29)34)23(32)19-12-15-10-16(27)13-20(37-3)25(15)38-19/h6-7,10-13,22,31,33H,4-5,8-9H2,1-3H3 |
| InChIKey | CSSMOOTXRLHCPJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 146.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.96 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|