C26H20FN3O3 — CID 108696427
(4E)-1-[(4-fluorophenyl)methyl]-4-[hydroxy(pyridin-4-yl)methylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione (PubChem CID 108696427) has the molecular formula C26H20FN3O3 and a molecular weight of 441.46 g/mol. Its IUPAC name is (4E)-1-[(4-fluorophenyl)methyl]-4-[hydroxy(pyridin-4-yl)methylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[(4-fluorophenyl)methyl]-4-[hydroxy(pyridin-4-yl)methylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108696427 |
| Molecular Formula | C26H20FN3O3 |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | (4E)-1-[(4-fluorophenyl)methyl]-4-[hydroxy(pyridin-4-yl)methylidene]-5-(2-methyl-1H-indol-3-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1[nH]c2ccccc2c1C1/C(=C(\O)c2ccncc2)C(=O)C(=O)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C26H20FN3O3/c1-15-21(19-4-2-3-5-20(19)29-15)23-22(24(31)17-10-12-28-13-11-17)25(32)26(33)30(23)14-16-6-8-18(27)9-7-16/h2-13,23,29,31H,14H2,1H3/b24-22+ |
| InChIKey | ISONSPZLXZWHKX-ZNTNEXAZSA-N |
| XLogP | 4.63 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|