C31H32N2O4S — CID 108696543
(4Z)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-1-[2-(1H-indol-3-yl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione (PubChem CID 108696543) has the molecular formula C31H32N2O4S and a molecular weight of 528.67 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-1-[2-(1H-indol-3-yl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-1-[2-(1H-indol-3-yl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108696543 |
| Molecular Formula | C31H32N2O4S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | (4Z)-4-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-1-[2-(1H-indol-3-yl)ethyl]-5-(3-methylthiophen-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc(/C(O)=C2/C(=O)C(=O)N(CCc3c[nH]c4ccccc34)C2c2sccc2C)ccc1OCC(C)C |
| InChI | InChI=1S/C31H32N2O4S/c1-18(2)17-37-25-10-9-21(15-20(25)4)28(34)26-27(30-19(3)12-14-38-30)33(31(36)29(26)35)13-11-22-16-32-24-8-6-5-7-23(22)24/h5-10,12,14-16,18,27,32,34H,11,13,17H2,1-4H3/b28-26- |
| InChIKey | XPCCTBMRAHZYLW-SGEDCAFJSA-N |
| XLogP | 6.55 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|