C27H31ClN2O6 — CID 108696667
[4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate (PubChem CID 108696667) has the molecular formula C27H31ClN2O6 and a molecular weight of 515.01 g/mol. Its IUPAC name is [4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate.
| Compound Name | [4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108696667 |
| Molecular Formula | C27H31ClN2O6 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | [4-[(3Z)-3-[(4-chloro-3-ethoxyphenyl)-hydroxymethylidene]-1-[2-(diethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]phenyl] acetate |
| SMILES | CCOc1cc(/C(O)=C2/C(=O)C(=O)N(CCN(CC)CC)C2c2ccc(OC(C)=O)cc2)ccc1Cl |
| InChI | InChI=1S/C27H31ClN2O6/c1-5-29(6-2)14-15-30-24(18-8-11-20(12-9-18)36-17(4)31)23(26(33)27(30)34)25(32)19-10-13-21(28)22(16-19)35-7-3/h8-13,16,24,32H,5-7,14-15H2,1-4H3/b25-23- |
| InChIKey | HEYPBUHLLVGFHF-BZZOAKBMSA-N |
| XLogP | 4.43 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|