C25H27BrN2O6 — CID 108696830
[5-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]-2-methoxyphenyl] acetate (PubChem CID 108696830) has the molecular formula C25H27BrN2O6 and a molecular weight of 531.40 g/mol. Its IUPAC name is [5-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]-2-methoxyphenyl] acetate.
| Compound Name | [5-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 108696830 |
| Molecular Formula | C25H27BrN2O6 |
| Molecular Weight | 531.40 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | [5-[(3Z)-3-[(4-bromo-3-methylphenyl)-hydroxymethylidene]-1-[2-(dimethylamino)ethyl]-4,5-dioxopyrrolidin-2-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1ccc(C2/C(=C(/O)c3ccc(Br)c(C)c3)C(=O)C(=O)N2CCN(C)C)cc1OC(C)=O |
| InChI | InChI=1S/C25H27BrN2O6/c1-14-12-17(6-8-18(14)26)23(30)21-22(28(11-10-27(3)4)25(32)24(21)31)16-7-9-19(33-5)20(13-16)34-15(2)29/h6-9,12-13,22,30H,10-11H2,1-5H3/b23-21- |
| InChIKey | SFZGMZDVJYYFQV-LNVKXUELSA-N |
| XLogP | 3.67 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|