C16H26O4 — CID 10869757
(1R,9R,10R,14R)-6-ethyl-12,12-dimethyl-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadecan-9-ol (PubChem CID 10869757) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is (1R,9R,10R,14R)-6-ethyl-12,12-dimethyl-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadecan-9-ol.
| Compound Name | (1R,9R,10R,14R)-6-ethyl-12,12-dimethyl-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadecan-9-ol |
|---|---|
| PubChem CID | 10869757 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (1R,9R,10R,14R)-6-ethyl-12,12-dimethyl-11,13,15-trioxatetracyclo[7.6.0.02,7.010,14]pentadecan-9-ol |
| SMILES | CCC1CCCC2C1C[C@@]1(O)[C@@H]2O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C16H26O4/c1-4-9-6-5-7-10-11(9)8-16(17)12(10)18-14-13(16)19-15(2,3)20-14/h9-14,17H,4-8H2,1-3H3/t9?,10?,11?,12-,13+,14-,16-/m1/s1 |
| InChIKey | SACWEOGUDPTPRL-PQJIUUGYSA-N |
| XLogP | 2.44 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |