C28H28N2O7S — CID 108697784
4-[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108697784) has the molecular formula C28H28N2O7S and a molecular weight of 536.61 g/mol. Its IUPAC name is 4-[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108697784 |
| Molecular Formula | C28H28N2O7S |
| Molecular Weight | 536.61 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 4-[(3E)-3-[hydroxy-[3-(2-methylpropoxy)phenyl]methylidene]-2-(4-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1ccc(C2/C(=C(\O)c3cccc(OCC(C)C)c3)C(=O)C(=O)N2c2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O7S/c1-17(2)16-37-22-6-4-5-19(15-22)26(31)24-25(18-7-11-21(36-3)12-8-18)30(28(33)27(24)32)20-9-13-23(14-10-20)38(29,34)35/h4-15,17,25,31H,16H2,1-3H3,(H2,29,34,35)/b26-24+ |
| InChIKey | SDHBXFVIPOWDMA-SHHOIMCASA-N |
| XLogP | 4.00 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|