C10H11F3O4S — CID 10869815
[(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] methanesulfonate (PubChem CID 10869815) has the molecular formula C10H11F3O4S and a molecular weight of 284.25 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] methanesulfonate.
| Compound Name | [(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] methanesulfonate |
|---|---|
| PubChem CID | 10869815 |
| Molecular Formula | C10H11F3O4S |
| Molecular Weight | 284.25 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | [(1S)-2,2,2-trifluoro-1-phenylmethoxyethyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H](OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C10H11F3O4S/c1-18(14,15)17-9(10(11,12)13)16-7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3/t9-/m0/s1 |
| InChIKey | LLMCGXBLAZTPLU-VIFPVBQESA-N |
| XLogP | 2.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|