C31H25N3O4 — CID 108698404
(4E)-1-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-[hydroxy(naphthalen-2-yl)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108698404) has the molecular formula C31H25N3O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is (4E)-1-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-[hydroxy(naphthalen-2-yl)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-[hydroxy(naphthalen-2-yl)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108698404 |
| Molecular Formula | C31H25N3O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | (4E)-1-(5,6-dimethyl-1H-benzimidazol-2-yl)-4-[hydroxy(naphthalen-2-yl)methylidene]-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3ccc4ccccc4c3)C(=O)C(=O)N2c2nc3cc(C)c(C)cc3[nH]2)cc1 |
| InChI | InChI=1S/C31H25N3O4/c1-17-14-24-25(15-18(17)2)33-31(32-24)34-27(20-10-12-23(38-3)13-11-20)26(29(36)30(34)37)28(35)22-9-8-19-6-4-5-7-21(19)16-22/h4-16,27,35H,1-3H3,(H,32,33)/b28-26+ |
| InChIKey | JYJAYDGHPGJXIF-BYCLXTJYSA-N |
| XLogP | 5.97 |
| TPSA | 95.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|