C29H27NO8 — CID 108698888
methyl 4-[[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate (PubChem CID 108698888) has the molecular formula C29H27NO8 and a molecular weight of 517.53 g/mol. Its IUPAC name is methyl 4-[[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108698888 |
| Molecular Formula | C29H27NO8 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | methyl 4-[[(3Z)-3-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)C(=O)/C(=C(\O)c3ccc(OC)c(OC)c3)C2c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C29H27NO8/c1-35-21-7-5-6-19(14-21)25-24(26(31)20-12-13-22(36-2)23(15-20)37-3)27(32)28(33)30(25)16-17-8-10-18(11-9-17)29(34)38-4/h5-15,25,31H,16H2,1-4H3/b26-24- |
| InChIKey | NHILCEXINLOJHV-LCUIJRPUSA-N |
| XLogP | 4.12 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|