C21H17N5O2 — CID 1086995
12,14-dimethyl-17-(3-methylphenyl)-1,8,9,12,14-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione (PubChem CID 1086995) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 12,14-dimethyl-17-(3-methylphenyl)-1,8,9,12,14-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione.
| Compound Name | 12,14-dimethyl-17-(3-methylphenyl)-1,8,9,12,14-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione |
|---|---|
| PubChem CID | 1086995 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 12,14-dimethyl-17-(3-methylphenyl)-1,8,9,12,14-pentazatetracyclo[8.7.0.02,7.011,16]heptadeca-2,4,6,8,10,16-hexaene-13,15-dione |
| SMILES | Cc1cccc(-c2c3c(=O)n(C)c(=O)n(C)c3c3nnc4ccccc4n23)c1 |
| InChI | InChI=1S/C21H17N5O2/c1-12-7-6-8-13(11-12)17-16-18(24(2)21(28)25(3)20(16)27)19-23-22-14-9-4-5-10-15(14)26(17)19/h4-11H,1-3H3 |
| InChIKey | FUKHHETYTFAPRM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |