C27H26N2O7S — CID 108699552
4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide (PubChem CID 108699552) has the molecular formula C27H26N2O7S and a molecular weight of 522.58 g/mol. Its IUPAC name is 4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide.
| Compound Name | 4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108699552 |
| Molecular Formula | C27H26N2O7S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 4-[(3E)-3-[hydroxy-(4-methoxy-2,5-dimethylphenyl)methylidene]-2-(3-methoxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzenesulfonamide |
| SMILES | COc1cccc(C2/C(=C(\O)c3cc(C)c(OC)cc3C)C(=O)C(=O)N2c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H26N2O7S/c1-15-13-22(36-4)16(2)12-21(15)25(30)23-24(17-6-5-7-19(14-17)35-3)29(27(32)26(23)31)18-8-10-20(11-9-18)37(28,33)34/h5-14,24,30H,1-4H3,(H2,28,33,34)/b25-23+ |
| InChIKey | GRAQJEBOJLWYCV-WJTDDFOZSA-N |
| XLogP | 3.59 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|