About 2-methylpropylbenzene
2-methylpropylbenzene (PubChem CID 10870) has the molecular formula C10H14
and a molecular weight of 134.22 g/mol. Its IUPAC name is 2-methylpropylbenzene.
Molecular Properties
| Compound Name | 2-methylpropylbenzene |
| PubChem CID | 10870 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 2-methylpropylbenzene |
| SMILES | CC(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | KXUHSQYYJYAXGZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylbenzene?
The IUPAC name of 2-methylpropylbenzene (CID 10870) is 2-methylpropylbenzene.
What is the SMILES notation for 2-methylpropylbenzene?
The canonical SMILES for 2-methylpropylbenzene is CC(C)Cc1ccccc1.
What is the InChIKey of 2-methylpropylbenzene?
The InChIKey is KXUHSQYYJYAXGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3.
What are the key properties of 2-methylpropylbenzene?
2-methylpropylbenzene has a molecular weight of 134.22 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylbenzene is sourced from PubChem (CID 10870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).